C22H28N4O5 — CID 46326975
2-(4-ethoxycarbonylpiperazin-1-yl)-6-(3-methylbutanoylamino)quinoline-4-carboxylic acid (PubChem CID 46326975) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-(4-ethoxycarbonylpiperazin-1-yl)-6-(3-methylbutanoylamino)quinoline-4-carboxylic acid.
| Compound Name | 2-(4-ethoxycarbonylpiperazin-1-yl)-6-(3-methylbutanoylamino)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 46326975 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 2-(4-ethoxycarbonylpiperazin-1-yl)-6-(3-methylbutanoylamino)quinoline-4-carboxylic acid |
| SMILES | CCOC(=O)N1CCN(c2cc(C(=O)O)c3cc(NC(=O)CC(C)C)ccc3n2)CC1 |
| InChI | InChI=1S/C22H28N4O5/c1-4-31-22(30)26-9-7-25(8-10-26)19-13-17(21(28)29)16-12-15(5-6-18(16)24-19)23-20(27)11-14(2)3/h5-6,12-14H,4,7-11H2,1-3H3,(H,23,27)(H,28,29) |
| InChIKey | SHVNGQLWZQYULF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |