C15H22N4O2S2 — CID 2420422
N-[(3S)-4-(cyclopropanecarbonylcarbamothioyl)-3-methylpiperazine-1-carbothioyl]cyclopropanecarboxamide (PubChem CID 2420422) has the molecular formula C15H22N4O2S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is N-[(3S)-4-(cyclopropanecarbonylcarbamothioyl)-3-methylpiperazine-1-carbothioyl]cyclopropanecarboxamide.
| Compound Name | N-[(3S)-4-(cyclopropanecarbonylcarbamothioyl)-3-methylpiperazine-1-carbothioyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 2420422 |
| Molecular Formula | C15H22N4O2S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[(3S)-4-(cyclopropanecarbonylcarbamothioyl)-3-methylpiperazine-1-carbothioyl]cyclopropanecarboxamide |
| SMILES | C[C@H]1CN(C(=S)NC(=O)C2CC2)CCN1C(=S)NC(=O)C1CC1 |
| InChI | InChI=1S/C15H22N4O2S2/c1-9-8-18(14(22)16-12(20)10-2-3-10)6-7-19(9)15(23)17-13(21)11-4-5-11/h9-11H,2-8H2,1H3,(H,16,20,22)(H,17,21,23)/t9-/m0/s1 |
| InChIKey | HOCIIDLHPIIMBC-VIFPVBQESA-N |
| XLogP | 0.61 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|