C24H35N3O3 — CID 42706699
N-[1-(4-benzoyl-3-methylpiperazin-1-yl)-3-methyl-1-oxobutan-2-yl]cyclohexanecarboxamide (PubChem CID 42706699) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is N-[1-(4-benzoyl-3-methylpiperazin-1-yl)-3-methyl-1-oxobutan-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[1-(4-benzoyl-3-methylpiperazin-1-yl)-3-methyl-1-oxobutan-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 42706699 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | N-[1-(4-benzoyl-3-methylpiperazin-1-yl)-3-methyl-1-oxobutan-2-yl]cyclohexanecarboxamide |
| SMILES | CC(C)C(NC(=O)C1CCCCC1)C(=O)N1CCN(C(=O)c2ccccc2)C(C)C1 |
| InChI | InChI=1S/C24H35N3O3/c1-17(2)21(25-22(28)19-10-6-4-7-11-19)24(30)26-14-15-27(18(3)16-26)23(29)20-12-8-5-9-13-20/h5,8-9,12-13,17-19,21H,4,6-7,10-11,14-16H2,1-3H3,(H,25,28) |
| InChIKey | VSGQKWUJTROJLW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |