C24H28FN3O3 — CID 42706708
N-[1-(4-benzoyl-3-methylpiperazin-1-yl)-3-methyl-1-oxobutan-2-yl]-3-fluorobenzamide (PubChem CID 42706708) has the molecular formula C24H28FN3O3 and a molecular weight of 425.50 g/mol. Its IUPAC name is N-[1-(4-benzoyl-3-methylpiperazin-1-yl)-3-methyl-1-oxobutan-2-yl]-3-fluorobenzamide.
| Compound Name | N-[1-(4-benzoyl-3-methylpiperazin-1-yl)-3-methyl-1-oxobutan-2-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 42706708 |
| Molecular Formula | C24H28FN3O3 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[1-(4-benzoyl-3-methylpiperazin-1-yl)-3-methyl-1-oxobutan-2-yl]-3-fluorobenzamide |
| SMILES | CC(C)C(NC(=O)c1cccc(F)c1)C(=O)N1CCN(C(=O)c2ccccc2)C(C)C1 |
| InChI | InChI=1S/C24H28FN3O3/c1-16(2)21(26-22(29)19-10-7-11-20(25)14-19)24(31)27-12-13-28(17(3)15-27)23(30)18-8-5-4-6-9-18/h4-11,14,16-17,21H,12-13,15H2,1-3H3,(H,26,29) |
| InChIKey | AMVKGGHACGRKKH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |