C25H29ClN4O5 — CID 42706651
2-chloro-N-[3-methyl-1-[3-methyl-4-(4-methylbenzoyl)piperazin-1-yl]-1-oxobutan-2-yl]-4-nitrobenzamide (PubChem CID 42706651) has the molecular formula C25H29ClN4O5 and a molecular weight of 500.98 g/mol. Its IUPAC name is 2-chloro-N-[3-methyl-1-[3-methyl-4-(4-methylbenzoyl)piperazin-1-yl]-1-oxobutan-2-yl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[3-methyl-1-[3-methyl-4-(4-methylbenzoyl)piperazin-1-yl]-1-oxobutan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 42706651 |
| Molecular Formula | C25H29ClN4O5 |
| Molecular Weight | 500.98 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 2-chloro-N-[3-methyl-1-[3-methyl-4-(4-methylbenzoyl)piperazin-1-yl]-1-oxobutan-2-yl]-4-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)C(NC(=O)c3ccc([N+](=O)[O-])cc3Cl)C(C)C)CC2C)cc1 |
| InChI | InChI=1S/C25H29ClN4O5/c1-15(2)22(27-23(31)20-10-9-19(30(34)35)13-21(20)26)25(33)28-11-12-29(17(4)14-28)24(32)18-7-5-16(3)6-8-18/h5-10,13,15,17,22H,11-12,14H2,1-4H3,(H,27,31) |
| InChIKey | WVIYHJOHGXFKGS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.98 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|