C19H24ClN3O6 — CID 55585212
2-chloro-N-[1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-methyl-1-oxobutan-2-yl]-4-nitrobenzamide (PubChem CID 55585212) has the molecular formula C19H24ClN3O6 and a molecular weight of 425.87 g/mol. Its IUPAC name is 2-chloro-N-[1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-methyl-1-oxobutan-2-yl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-methyl-1-oxobutan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 55585212 |
| Molecular Formula | C19H24ClN3O6 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-chloro-N-[1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-methyl-1-oxobutan-2-yl]-4-nitrobenzamide |
| SMILES | CC(C)C(NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C19H24ClN3O6/c1-12(2)16(18(25)22-7-5-19(6-8-22)28-9-10-29-19)21-17(24)14-4-3-13(23(26)27)11-15(14)20/h3-4,11-12,16H,5-10H2,1-2H3,(H,21,24) |
| InChIKey | JSSAYNSTSZVTKA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|