C24H27ClN4O5 — CID 47009685
1-[2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoyl]-N-phenylpiperidine-4-carboxamide (PubChem CID 47009685) has the molecular formula C24H27ClN4O5 and a molecular weight of 486.96 g/mol. Its IUPAC name is 1-[2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoyl]-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-[2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoyl]-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 47009685 |
| Molecular Formula | C24H27ClN4O5 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 1-[2-[(2-chloro-4-nitrobenzoyl)amino]-3-methylbutanoyl]-N-phenylpiperidine-4-carboxamide |
| SMILES | CC(C)C(NC(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)N1CCC(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C24H27ClN4O5/c1-15(2)21(27-23(31)19-9-8-18(29(33)34)14-20(19)25)24(32)28-12-10-16(11-13-28)22(30)26-17-6-4-3-5-7-17/h3-9,14-16,21H,10-13H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | KBSJOPXUDTYDPX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|