C24H28ClN3O3 — CID 55551043
N-[1-[4-(4-chlorobenzoyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]-4-methylbenzamide (PubChem CID 55551043) has the molecular formula C24H28ClN3O3 and a molecular weight of 441.96 g/mol. Its IUPAC name is N-[1-[4-(4-chlorobenzoyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]-4-methylbenzamide.
| Compound Name | N-[1-[4-(4-chlorobenzoyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 55551043 |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | N-[1-[4-(4-chlorobenzoyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(C(=O)N2CCN(C(=O)c3ccc(Cl)cc3)CC2)C(C)C)cc1 |
| InChI | InChI=1S/C24H28ClN3O3/c1-16(2)21(26-22(29)18-6-4-17(3)5-7-18)24(31)28-14-12-27(13-15-28)23(30)19-8-10-20(25)11-9-19/h4-11,16,21H,12-15H2,1-3H3,(H,26,29) |
| InChIKey | YFTGLRRADZTWMO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |