C20H31ClN4O4S — CID 24598469
4-chloro-N-[1-[4-(diethylsulfamoyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 24598469) has the molecular formula C20H31ClN4O4S and a molecular weight of 459.01 g/mol. Its IUPAC name is 4-chloro-N-[1-[4-(diethylsulfamoyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[4-(diethylsulfamoyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 24598469 |
| Molecular Formula | C20H31ClN4O4S |
| Molecular Weight | 459.01 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 4-chloro-N-[1-[4-(diethylsulfamoyl)piperazin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(C(=O)C(NC(=O)c2ccc(Cl)cc2)C(C)C)CC1 |
| InChI | InChI=1S/C20H31ClN4O4S/c1-5-24(6-2)30(28,29)25-13-11-23(12-14-25)20(27)18(15(3)4)22-19(26)16-7-9-17(21)10-8-16/h7-10,15,18H,5-6,11-14H2,1-4H3,(H,22,26) |
| InChIKey | GFWBQTBVUYHGDC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.01 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |