C18H27N3O2S — CID 155539086
tert-butyl 3-methyl-4-[(4-methylphenyl)carbamothioyl]piperazine-1-carboxylate (PubChem CID 155539086) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is tert-butyl 3-methyl-4-[(4-methylphenyl)carbamothioyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-methyl-4-[(4-methylphenyl)carbamothioyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155539086 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | tert-butyl 3-methyl-4-[(4-methylphenyl)carbamothioyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(NC(=S)N2CCN(C(=O)OC(C)(C)C)CC2C)cc1 |
| InChI | InChI=1S/C18H27N3O2S/c1-13-6-8-15(9-7-13)19-16(24)21-11-10-20(12-14(21)2)17(22)23-18(3,4)5/h6-9,14H,10-12H2,1-5H3,(H,19,24) |
| InChIKey | YNIVSCUVOJGLQU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|