C18H26BrN3O4 — CID 71906472
tert-butyl 4-[(3-bromo-4-methoxyphenyl)carbamoyl]-3-methylpiperazine-1-carboxylate (PubChem CID 71906472) has the molecular formula C18H26BrN3O4 and a molecular weight of 428.33 g/mol. Its IUPAC name is tert-butyl 4-[(3-bromo-4-methoxyphenyl)carbamoyl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-bromo-4-methoxyphenyl)carbamoyl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 71906472 |
| Molecular Formula | C18H26BrN3O4 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | tert-butyl 4-[(3-bromo-4-methoxyphenyl)carbamoyl]-3-methylpiperazine-1-carboxylate |
| SMILES | COc1ccc(NC(=O)N2CCN(C(=O)OC(C)(C)C)CC2C)cc1Br |
| InChI | InChI=1S/C18H26BrN3O4/c1-12-11-21(17(24)26-18(2,3)4)8-9-22(12)16(23)20-13-6-7-15(25-5)14(19)10-13/h6-7,10,12H,8-9,11H2,1-5H3,(H,20,23) |
| InChIKey | OGALAIALPYYUBM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |