C22H34N4O3 — CID 75439066
tert-butyl (3S)-3-methyl-4-[(2-piperidin-1-ylphenyl)carbamoyl]piperazine-1-carboxylate (PubChem CID 75439066) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is tert-butyl (3S)-3-methyl-4-[(2-piperidin-1-ylphenyl)carbamoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-methyl-4-[(2-piperidin-1-ylphenyl)carbamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 75439066 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | tert-butyl (3S)-3-methyl-4-[(2-piperidin-1-ylphenyl)carbamoyl]piperazine-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)CCN1C(=O)Nc1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C22H34N4O3/c1-17-16-25(21(28)29-22(2,3)4)14-15-26(17)20(27)23-18-10-6-7-11-19(18)24-12-8-5-9-13-24/h6-7,10-11,17H,5,8-9,12-16H2,1-4H3,(H,23,27)/t17-/m0/s1 |
| InChIKey | YFDLKDAMCSNCLB-KRWDZBQOSA-N |
| XLogP | 4.15 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |