C8H14N2O — CID 102517238
N-prop-2-enylpyrrolidine-1-carboxamide (PubChem CID 102517238) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is N-prop-2-enylpyrrolidine-1-carboxamide.
| Compound Name | N-prop-2-enylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 102517238 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | N-prop-2-enylpyrrolidine-1-carboxamide |
| SMILES | C=CCNC(=O)N1CCCC1 |
| InChI | InChI=1S/C8H14N2O/c1-2-5-9-8(11)10-6-3-4-7-10/h2H,1,3-7H2,(H,9,11) |
| InChIKey | QWTVAHVMLYSIMT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|