C9H14N2O — CID 130725756
N-prop-2-enyl-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 130725756) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is N-prop-2-enyl-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-prop-2-enyl-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 130725756 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | N-prop-2-enyl-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | C=CCNC(=O)N1CC=CCC1 |
| InChI | InChI=1S/C9H14N2O/c1-2-6-10-9(12)11-7-4-3-5-8-11/h2-4H,1,5-8H2,(H,10,12) |
| InChIKey | ZPEYEHGGSFNDGW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|