C14H24N2O3 — CID 114411666
3-[(3,6-dihydro-2H-pyridine-1-carbonylamino)methyl]-5-methylhexanoic acid (PubChem CID 114411666) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-[(3,6-dihydro-2H-pyridine-1-carbonylamino)methyl]-5-methylhexanoic acid.
| Compound Name | 3-[(3,6-dihydro-2H-pyridine-1-carbonylamino)methyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 114411666 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 3-[(3,6-dihydro-2H-pyridine-1-carbonylamino)methyl]-5-methylhexanoic acid |
| SMILES | CC(C)CC(CNC(=O)N1CC=CCC1)CC(=O)O |
| InChI | InChI=1S/C14H24N2O3/c1-11(2)8-12(9-13(17)18)10-15-14(19)16-6-4-3-5-7-16/h3-4,11-12H,5-10H2,1-2H3,(H,15,19)(H,17,18) |
| InChIKey | PBJCKHJOAJAEAE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|