C8H12F2N2O — CID 131224020
N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 131224020) has the molecular formula C8H12F2N2O and a molecular weight of 190.19 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 131224020 |
| Molecular Formula | C8H12F2N2O |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | O=C(NCC(F)F)N1CC=CCC1 |
| InChI | InChI=1S/C8H12F2N2O/c9-7(10)6-11-8(13)12-4-2-1-3-5-12/h1-2,7H,3-6H2,(H,11,13) |
| InChIKey | SAVFSDDABHHJNC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|