About N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide
N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 131224020) has the molecular formula C8H12F2N2O
and a molecular weight of 190.19 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide |
| PubChem CID | 131224020 |
| Molecular Formula | C8H12F2N2O |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | O=C(NCC(F)F)N1CC=CCC1 |
| InChI | InChI=1S/C8H12F2N2O/c9-7(10)6-11-8(13)12-4-2-1-3-5-12/h1-2,7H,3-6H2,(H,11,13) |
| InChIKey | SAVFSDDABHHJNC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide?
The IUPAC name of N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide (CID 131224020) is N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide.
What is the SMILES notation for N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide?
The canonical SMILES for N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide is O=C(NCC(F)F)N1CC=CCC1.
What is the InChIKey of N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide?
The InChIKey is SAVFSDDABHHJNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2N2O/c9-7(10)6-11-8(13)12-4-2-1-3-5-12/h1-2,7H,3-6H2,(H,11,13).
What are the key properties of N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide?
N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide has a molecular weight of 190.19 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)-3,6-dihydro-2H-pyridine-1-carboxamide is sourced from PubChem (CID 131224020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).