C16H21FN2O — CID 90608883
3-(4-fluorophenyl)-N-prop-2-enylazepane-1-carboxamide (PubChem CID 90608883) has the molecular formula C16H21FN2O and a molecular weight of 276.36 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-prop-2-enylazepane-1-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-prop-2-enylazepane-1-carboxamide |
|---|---|
| PubChem CID | 90608883 |
| Molecular Formula | C16H21FN2O |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-(4-fluorophenyl)-N-prop-2-enylazepane-1-carboxamide |
| SMILES | C=CCNC(=O)N1CCCCC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H21FN2O/c1-2-10-18-16(20)19-11-4-3-5-14(12-19)13-6-8-15(17)9-7-13/h2,6-9,14H,1,3-5,10-12H2,(H,18,20) |
| InChIKey | QOOFMGNXZLSETE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|