C20H22ClFN2O — CID 99979735
(3R)-N-[(4-chlorophenyl)methyl]-3-(4-fluorophenyl)azepane-1-carboxamide (PubChem CID 99979735) has the molecular formula C20H22ClFN2O and a molecular weight of 360.86 g/mol. Its IUPAC name is (3R)-N-[(4-chlorophenyl)methyl]-3-(4-fluorophenyl)azepane-1-carboxamide.
| Compound Name | (3R)-N-[(4-chlorophenyl)methyl]-3-(4-fluorophenyl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 99979735 |
| Molecular Formula | C20H22ClFN2O |
| Molecular Weight | 360.86 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (3R)-N-[(4-chlorophenyl)methyl]-3-(4-fluorophenyl)azepane-1-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)N1CCCC[C@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H22ClFN2O/c21-18-8-4-15(5-9-18)13-23-20(25)24-12-2-1-3-17(14-24)16-6-10-19(22)11-7-16/h4-11,17H,1-3,12-14H2,(H,23,25)/t17-/m0/s1 |
| InChIKey | WSPFMYOYDKJHCK-KRWDZBQOSA-N |
| XLogP | 4.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.86 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |