C24H25ClN2O — CID 121146736
3-(4-chlorophenyl)-N-(naphthalen-1-ylmethyl)azepane-1-carboxamide (PubChem CID 121146736) has the molecular formula C24H25ClN2O and a molecular weight of 392.93 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(naphthalen-1-ylmethyl)azepane-1-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-(naphthalen-1-ylmethyl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 121146736 |
| Molecular Formula | C24H25ClN2O |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(naphthalen-1-ylmethyl)azepane-1-carboxamide |
| SMILES | O=C(NCc1cccc2ccccc12)N1CCCCC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C24H25ClN2O/c25-22-13-11-18(12-14-22)21-7-3-4-15-27(17-21)24(28)26-16-20-9-5-8-19-6-1-2-10-23(19)20/h1-2,5-6,8-14,21H,3-4,7,15-17H2,(H,26,28) |
| InChIKey | VXXHLJRLLMBAFF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |