C26H26ClNO — CID 121146584
1-[3-(4-chlorophenyl)azepan-1-yl]-2-(4-phenylphenyl)ethanone (PubChem CID 121146584) has the molecular formula C26H26ClNO and a molecular weight of 403.95 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)azepan-1-yl]-2-(4-phenylphenyl)ethanone.
| Compound Name | 1-[3-(4-chlorophenyl)azepan-1-yl]-2-(4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 121146584 |
| Molecular Formula | C26H26ClNO |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 1-[3-(4-chlorophenyl)azepan-1-yl]-2-(4-phenylphenyl)ethanone |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)N1CCCCC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C26H26ClNO/c27-25-15-13-23(14-16-25)24-8-4-5-17-28(19-24)26(29)18-20-9-11-22(12-10-20)21-6-2-1-3-7-21/h1-3,6-7,9-16,24H,4-5,8,17-19H2 |
| InChIKey | JZQHMZHJAHWJDQ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |