C18H20ClNOS — CID 121146683
1-[3-(4-chlorophenyl)azepan-1-yl]-2-thiophen-3-ylethanone (PubChem CID 121146683) has the molecular formula C18H20ClNOS and a molecular weight of 333.88 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)azepan-1-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[3-(4-chlorophenyl)azepan-1-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 121146683 |
| Molecular Formula | C18H20ClNOS |
| Molecular Weight | 333.88 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 1-[3-(4-chlorophenyl)azepan-1-yl]-2-thiophen-3-ylethanone |
| SMILES | O=C(Cc1ccsc1)N1CCCCC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H20ClNOS/c19-17-6-4-15(5-7-17)16-3-1-2-9-20(12-16)18(21)11-14-8-10-22-13-14/h4-8,10,13,16H,1-3,9,11-12H2 |
| InChIKey | KZHRLJSDSGDUFQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.88 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |