C21H24ClNO2 — CID 121146535
1-[3-(4-chlorophenyl)azepan-1-yl]-2-(4-methylphenoxy)ethanone (PubChem CID 121146535) has the molecular formula C21H24ClNO2 and a molecular weight of 357.88 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)azepan-1-yl]-2-(4-methylphenoxy)ethanone.
| Compound Name | 1-[3-(4-chlorophenyl)azepan-1-yl]-2-(4-methylphenoxy)ethanone |
|---|---|
| PubChem CID | 121146535 |
| Molecular Formula | C21H24ClNO2 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-[3-(4-chlorophenyl)azepan-1-yl]-2-(4-methylphenoxy)ethanone |
| SMILES | Cc1ccc(OCC(=O)N2CCCCC(c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C21H24ClNO2/c1-16-5-11-20(12-6-16)25-15-21(24)23-13-3-2-4-18(14-23)17-7-9-19(22)10-8-17/h5-12,18H,2-4,13-15H2,1H3 |
| InChIKey | BXOHJBATVBVMSR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |