C17H24FNO — CID 90608728
1-[3-(4-fluorophenyl)azepan-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 90608728) has the molecular formula C17H24FNO and a molecular weight of 277.38 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)azepan-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[3-(4-fluorophenyl)azepan-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 90608728 |
| Molecular Formula | C17H24FNO |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 1-[3-(4-fluorophenyl)azepan-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1CCCCC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C17H24FNO/c1-17(2,3)16(20)19-11-5-4-6-14(12-19)13-7-9-15(18)10-8-13/h7-10,14H,4-6,11-12H2,1-3H3 |
| InChIKey | RQIQWYFLJGUBTG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |