C15H27N3O2 — CID 96532461
(3S)-3-[(2,2-dimethylpropanoylamino)methyl]-N-prop-2-enylpiperidine-1-carboxamide (PubChem CID 96532461) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is (3S)-3-[(2,2-dimethylpropanoylamino)methyl]-N-prop-2-enylpiperidine-1-carboxamide.
| Compound Name | (3S)-3-[(2,2-dimethylpropanoylamino)methyl]-N-prop-2-enylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 96532461 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | (3S)-3-[(2,2-dimethylpropanoylamino)methyl]-N-prop-2-enylpiperidine-1-carboxamide |
| SMILES | C=CCNC(=O)N1CCC[C@@H](CNC(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C15H27N3O2/c1-5-8-16-14(20)18-9-6-7-12(11-18)10-17-13(19)15(2,3)4/h5,12H,1,6-11H2,2-4H3,(H,16,20)(H,17,19)/t12-/m0/s1 |
| InChIKey | NAZGASZLSCZSQC-LBPRGKRZSA-N |
| XLogP | 1.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|