C26H28N4O2S2 — CID 28503022
4-[(1R,2S)-2-(benzenesulfonamido)-1,2-dihydroacenaphthylen-1-yl]-N-prop-2-enylpiperazine-1-carbothioamide (PubChem CID 28503022) has the molecular formula C26H28N4O2S2 and a molecular weight of 492.67 g/mol. Its IUPAC name is 4-[(1R,2S)-2-(benzenesulfonamido)-1,2-dihydroacenaphthylen-1-yl]-N-prop-2-enylpiperazine-1-carbothioamide.
| Compound Name | 4-[(1R,2S)-2-(benzenesulfonamido)-1,2-dihydroacenaphthylen-1-yl]-N-prop-2-enylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 28503022 |
| Molecular Formula | C26H28N4O2S2 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 4-[(1R,2S)-2-(benzenesulfonamido)-1,2-dihydroacenaphthylen-1-yl]-N-prop-2-enylpiperazine-1-carbothioamide |
| SMILES | C=CCNC(=S)N1CCN([C@@H]2c3cccc4cccc(c34)[C@@H]2NS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H28N4O2S2/c1-2-14-27-26(33)30-17-15-29(16-18-30)25-22-13-7-9-19-8-6-12-21(23(19)22)24(25)28-34(31,32)20-10-4-3-5-11-20/h2-13,24-25,28H,1,14-18H2,(H,27,33)/t24-,25+/m0/s1 |
| InChIKey | RNGULWNDVNHGRR-LOSJGSFVSA-N |
| XLogP | 3.59 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|