C29H28N4O2S2 — CID 3792361
4-[2-(benzenesulfonamido)-1,2-dihydroacenaphthylen-1-yl]-N-phenylpiperazine-1-carbothioamide (PubChem CID 3792361) has the molecular formula C29H28N4O2S2 and a molecular weight of 528.70 g/mol. Its IUPAC name is 4-[2-(benzenesulfonamido)-1,2-dihydroacenaphthylen-1-yl]-N-phenylpiperazine-1-carbothioamide.
| Compound Name | 4-[2-(benzenesulfonamido)-1,2-dihydroacenaphthylen-1-yl]-N-phenylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3792361 |
| Molecular Formula | C29H28N4O2S2 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | 4-[2-(benzenesulfonamido)-1,2-dihydroacenaphthylen-1-yl]-N-phenylpiperazine-1-carbothioamide |
| SMILES | O=S(=O)(NC1c2cccc3cccc(c23)C1N1CCN(C(=S)Nc2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C29H28N4O2S2/c34-37(35,23-13-5-2-6-14-23)31-27-24-15-7-9-21-10-8-16-25(26(21)24)28(27)32-17-19-33(20-18-32)29(36)30-22-11-3-1-4-12-22/h1-16,27-28,31H,17-20H2,(H,30,36) |
| InChIKey | KKHYPVVPTANLBR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|