C26H27ClN4O2S2 — CID 28587015
4-[(1R,2S)-2-[(4-chlorophenyl)sulfonylamino]-1,2-dihydroacenaphthylen-1-yl]-N-prop-2-enylpiperazine-1-carbothioamide (PubChem CID 28587015) has the molecular formula C26H27ClN4O2S2 and a molecular weight of 527.12 g/mol. Its IUPAC name is 4-[(1R,2S)-2-[(4-chlorophenyl)sulfonylamino]-1,2-dihydroacenaphthylen-1-yl]-N-prop-2-enylpiperazine-1-carbothioamide.
| Compound Name | 4-[(1R,2S)-2-[(4-chlorophenyl)sulfonylamino]-1,2-dihydroacenaphthylen-1-yl]-N-prop-2-enylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 28587015 |
| Molecular Formula | C26H27ClN4O2S2 |
| Molecular Weight | 527.12 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 4-[(1R,2S)-2-[(4-chlorophenyl)sulfonylamino]-1,2-dihydroacenaphthylen-1-yl]-N-prop-2-enylpiperazine-1-carbothioamide |
| SMILES | C=CCNC(=S)N1CCN([C@@H]2c3cccc4cccc(c34)[C@@H]2NS(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H27ClN4O2S2/c1-2-13-28-26(34)31-16-14-30(15-17-31)25-22-8-4-6-18-5-3-7-21(23(18)22)24(25)29-35(32,33)20-11-9-19(27)10-12-20/h2-12,24-25,29H,1,13-17H2,(H,28,34)/t24-,25+/m0/s1 |
| InChIKey | KGGARYKKQPKCEC-LOSJGSFVSA-N |
| XLogP | 4.25 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.12 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|