C22H25N2O2S+ — CID 7014367
[(1S,2S)-2-(benzenesulfonamido)-1,2-dihydroacenaphthylen-1-yl]-diethylazanium (PubChem CID 7014367) has the molecular formula C22H25N2O2S+ and a molecular weight of 381.52 g/mol. Its IUPAC name is [(1S,2S)-2-(benzenesulfonamido)-1,2-dihydroacenaphthylen-1-yl]-diethylazanium.
| Compound Name | [(1S,2S)-2-(benzenesulfonamido)-1,2-dihydroacenaphthylen-1-yl]-diethylazanium |
|---|---|
| PubChem CID | 7014367 |
| Molecular Formula | C22H25N2O2S+ |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | [(1S,2S)-2-(benzenesulfonamido)-1,2-dihydroacenaphthylen-1-yl]-diethylazanium |
| SMILES | CC[NH+](CC)[C@H]1c2cccc3cccc(c23)[C@@H]1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O2S/c1-3-24(4-2)22-19-15-9-11-16-10-8-14-18(20(16)19)21(22)23-27(25,26)17-12-6-5-7-13-17/h5-15,21-23H,3-4H2,1-2H3/p+1/t21-,22-/m0/s1 |
| InChIKey | NPKQMNSCEOXHMN-VXKWHMMOSA-O |
| XLogP | 2.84 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |