C12H11ClN2O4S3 — CID 51119320
N-[2-[(5-chlorothiophen-2-yl)sulfonylamino]-2-oxoethyl]-N-methylthiophene-2-carboxamide (PubChem CID 51119320) has the molecular formula C12H11ClN2O4S3 and a molecular weight of 378.88 g/mol. Its IUPAC name is N-[2-[(5-chlorothiophen-2-yl)sulfonylamino]-2-oxoethyl]-N-methylthiophene-2-carboxamide.
| Compound Name | N-[2-[(5-chlorothiophen-2-yl)sulfonylamino]-2-oxoethyl]-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 51119320 |
| Molecular Formula | C12H11ClN2O4S3 |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | N-[2-[(5-chlorothiophen-2-yl)sulfonylamino]-2-oxoethyl]-N-methylthiophene-2-carboxamide |
| SMILES | CN(CC(=O)NS(=O)(=O)c1ccc(Cl)s1)C(=O)c1cccs1 |
| InChI | InChI=1S/C12H11ClN2O4S3/c1-15(12(17)8-3-2-6-20-8)7-10(16)14-22(18,19)11-5-4-9(13)21-11/h2-6H,7H2,1H3,(H,14,16) |
| InChIKey | VPTIFSIOYVLPQO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |