C16H19ClN4O3S2 — CID 9255284
5-chloro-N-methyl-N-[2-oxo-2-(4-pyridin-4-ylpiperazin-1-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 9255284) has the molecular formula C16H19ClN4O3S2 and a molecular weight of 414.94 g/mol. Its IUPAC name is 5-chloro-N-methyl-N-[2-oxo-2-(4-pyridin-4-ylpiperazin-1-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-methyl-N-[2-oxo-2-(4-pyridin-4-ylpiperazin-1-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 9255284 |
| Molecular Formula | C16H19ClN4O3S2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 5-chloro-N-methyl-N-[2-oxo-2-(4-pyridin-4-ylpiperazin-1-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | CN(CC(=O)N1CCN(c2ccncc2)CC1)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H19ClN4O3S2/c1-19(26(23,24)16-3-2-14(17)25-16)12-15(22)21-10-8-20(9-11-21)13-4-6-18-7-5-13/h2-7H,8-12H2,1H3 |
| InChIKey | NNZIVQIRSNTRIS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |