C11H15BrClN3O3S2 — CID 80577583
5-bromo-4-chloro-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)thiophene-2-sulfonamide (PubChem CID 80577583) has the molecular formula C11H15BrClN3O3S2 and a molecular weight of 416.75 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80577583 |
| Molecular Formula | C11H15BrClN3O3S2 |
| Molecular Weight | 416.75 g/mol |
| Exact Mass | 414.94 |
| IUPAC Name | 5-bromo-4-chloro-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)thiophene-2-sulfonamide |
| SMILES | CN(CC(=O)N1CCNCC1)S(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C11H15BrClN3O3S2/c1-15(7-9(17)16-4-2-14-3-5-16)21(18,19)10-6-8(13)11(12)20-10/h6,14H,2-5,7H2,1H3 |
| InChIKey | QMQJKPQACWLTRM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.75 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |