C12H12N2O3S3 — CID 106272065
5-[(3-hydroxyphenyl)-methylsulfamoyl]thiophene-2-carbothioamide (PubChem CID 106272065) has the molecular formula C12H12N2O3S3 and a molecular weight of 328.44 g/mol. Its IUPAC name is 5-[(3-hydroxyphenyl)-methylsulfamoyl]thiophene-2-carbothioamide.
| Compound Name | 5-[(3-hydroxyphenyl)-methylsulfamoyl]thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106272065 |
| Molecular Formula | C12H12N2O3S3 |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 5-[(3-hydroxyphenyl)-methylsulfamoyl]thiophene-2-carbothioamide |
| SMILES | CN(c1cccc(O)c1)S(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C12H12N2O3S3/c1-14(8-3-2-4-9(15)7-8)20(16,17)11-6-5-10(19-11)12(13)18/h2-7,15H,1H3,(H2,13,18) |
| InChIKey | YTNOVWDLKJEWAR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|