C13H16N2O3S2 — CID 107736812
5-(2-aminoethyl)-N-(3-hydroxyphenyl)-N-methylthiophene-2-sulfonamide (PubChem CID 107736812) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 5-(2-aminoethyl)-N-(3-hydroxyphenyl)-N-methylthiophene-2-sulfonamide.
| Compound Name | 5-(2-aminoethyl)-N-(3-hydroxyphenyl)-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 107736812 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 5-(2-aminoethyl)-N-(3-hydroxyphenyl)-N-methylthiophene-2-sulfonamide |
| SMILES | CN(c1cccc(O)c1)S(=O)(=O)c1ccc(CCN)s1 |
| InChI | InChI=1S/C13H16N2O3S2/c1-15(10-3-2-4-11(16)9-10)20(17,18)13-6-5-12(19-13)7-8-14/h2-6,9,16H,7-8,14H2,1H3 |
| InChIKey | UMFMQWIGDJMSEZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |