C12H19N3O3S3 — CID 106272011
5-[[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]sulfonyl]thiophene-2-carbothioamide (PubChem CID 106272011) has the molecular formula C12H19N3O3S3 and a molecular weight of 349.50 g/mol. Its IUPAC name is 5-[[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]sulfonyl]thiophene-2-carbothioamide.
| Compound Name | 5-[[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]sulfonyl]thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106272011 |
| Molecular Formula | C12H19N3O3S3 |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 5-[[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]sulfonyl]thiophene-2-carbothioamide |
| SMILES | NC(=S)c1ccc(S(=O)(=O)N2CCCN(CCO)CC2)s1 |
| InChI | InChI=1S/C12H19N3O3S3/c13-12(19)10-2-3-11(20-10)21(17,18)15-5-1-4-14(6-7-15)8-9-16/h2-3,16H,1,4-9H2,(H2,13,19) |
| InChIKey | MUCMZYNTEXWTKN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|