C10H11N5O2S3 — CID 106271349
5-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylsulfonyl)thiophene-2-carbothioamide (PubChem CID 106271349) has the molecular formula C10H11N5O2S3 and a molecular weight of 329.43 g/mol. Its IUPAC name is 5-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylsulfonyl)thiophene-2-carbothioamide.
| Compound Name | 5-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylsulfonyl)thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106271349 |
| Molecular Formula | C10H11N5O2S3 |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 5-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylsulfonyl)thiophene-2-carbothioamide |
| SMILES | NC(=S)c1ccc(S(=O)(=O)N2CCn3cnnc3C2)s1 |
| InChI | InChI=1S/C10H11N5O2S3/c11-10(18)7-1-2-9(19-7)20(16,17)15-4-3-14-6-12-13-8(14)5-15/h1-2,6H,3-5H2,(H2,11,18) |
| InChIKey | ZYCWYCNLESULIU-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|