C13H24N4O2S2 — CID 106091562
1-(3-aminopropyl)-N-(3-ethylsulfanylcyclopentyl)pyrazole-4-sulfonamide (PubChem CID 106091562) has the molecular formula C13H24N4O2S2 and a molecular weight of 332.50 g/mol. Its IUPAC name is 1-(3-aminopropyl)-N-(3-ethylsulfanylcyclopentyl)pyrazole-4-sulfonamide.
| Compound Name | 1-(3-aminopropyl)-N-(3-ethylsulfanylcyclopentyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106091562 |
| Molecular Formula | C13H24N4O2S2 |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-(3-aminopropyl)-N-(3-ethylsulfanylcyclopentyl)pyrazole-4-sulfonamide |
| SMILES | CCSC1CCC(NS(=O)(=O)c2cnn(CCCN)c2)C1 |
| InChI | InChI=1S/C13H24N4O2S2/c1-2-20-12-5-4-11(8-12)16-21(18,19)13-9-15-17(10-13)7-3-6-14/h9-12,16H,2-8,14H2,1H3 |
| InChIKey | APGCBSDJJORRBC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |