C11H14BrFN2O2S — CID 55101027
2-bromo-N-[2-(cyclopropylamino)ethyl]-4-fluorobenzenesulfonamide (PubChem CID 55101027) has the molecular formula C11H14BrFN2O2S and a molecular weight of 337.21 g/mol. Its IUPAC name is 2-bromo-N-[2-(cyclopropylamino)ethyl]-4-fluorobenzenesulfonamide.
| Compound Name | 2-bromo-N-[2-(cyclopropylamino)ethyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 55101027 |
| Molecular Formula | C11H14BrFN2O2S |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 2-bromo-N-[2-(cyclopropylamino)ethyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCNC1CC1)c1ccc(F)cc1Br |
| InChI | InChI=1S/C11H14BrFN2O2S/c12-10-7-8(13)1-4-11(10)18(16,17)15-6-5-14-9-2-3-9/h1,4,7,9,14-15H,2-3,5-6H2 |
| InChIKey | OIOHWTXTDICORE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|