C12H14BrNO5S — CID 43610009
3-bromo-4-(oxan-4-ylsulfamoyl)benzoic acid (PubChem CID 43610009) has the molecular formula C12H14BrNO5S and a molecular weight of 364.22 g/mol. Its IUPAC name is 3-bromo-4-(oxan-4-ylsulfamoyl)benzoic acid.
| Compound Name | 3-bromo-4-(oxan-4-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 43610009 |
| Molecular Formula | C12H14BrNO5S |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | 3-bromo-4-(oxan-4-ylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NC2CCOCC2)c(Br)c1 |
| InChI | InChI=1S/C12H14BrNO5S/c13-10-7-8(12(15)16)1-2-11(10)20(17,18)14-9-3-5-19-6-4-9/h1-2,7,9,14H,3-6H2,(H,15,16) |
| InChIKey | NUBPQVMSQCZYOQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |