C12H15ClFNO2S — CID 114632190
N-(3-chloro-2,2-dimethylcyclobutyl)-3-fluorobenzenesulfonamide (PubChem CID 114632190) has the molecular formula C12H15ClFNO2S and a molecular weight of 291.78 g/mol. Its IUPAC name is N-(3-chloro-2,2-dimethylcyclobutyl)-3-fluorobenzenesulfonamide.
| Compound Name | N-(3-chloro-2,2-dimethylcyclobutyl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 114632190 |
| Molecular Formula | C12H15ClFNO2S |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | N-(3-chloro-2,2-dimethylcyclobutyl)-3-fluorobenzenesulfonamide |
| SMILES | CC1(C)C(Cl)CC1NS(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C12H15ClFNO2S/c1-12(2)10(13)7-11(12)15-18(16,17)9-5-3-4-8(14)6-9/h3-6,10-11,15H,7H2,1-2H3 |
| InChIKey | VQVCBSBRZXRKGS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|