C12H15ClFNO3S — CID 103836042
3-chloro-4-fluoro-N-[2-(hydroxymethyl)cyclopentyl]benzenesulfonamide (PubChem CID 103836042) has the molecular formula C12H15ClFNO3S and a molecular weight of 307.77 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-[2-(hydroxymethyl)cyclopentyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-fluoro-N-[2-(hydroxymethyl)cyclopentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103836042 |
| Molecular Formula | C12H15ClFNO3S |
| Molecular Weight | 307.77 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 3-chloro-4-fluoro-N-[2-(hydroxymethyl)cyclopentyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCC1CO)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClFNO3S/c13-10-6-9(4-5-11(10)14)19(17,18)15-12-3-1-2-8(12)7-16/h4-6,8,12,15-16H,1-3,7H2 |
| InChIKey | WXCVENZZWVQBHI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.77 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |