C12H17ClN2O4S — CID 106364168
5-chloro-N-[2-(hydroxymethyl)cyclohexyl]-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 106364168) has the molecular formula C12H17ClN2O4S and a molecular weight of 320.80 g/mol. Its IUPAC name is 5-chloro-N-[2-(hydroxymethyl)cyclohexyl]-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-[2-(hydroxymethyl)cyclohexyl]-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106364168 |
| Molecular Formula | C12H17ClN2O4S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 5-chloro-N-[2-(hydroxymethyl)cyclohexyl]-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | O=c1[nH]cc(S(=O)(=O)NC2CCCCC2CO)cc1Cl |
| InChI | InChI=1S/C12H17ClN2O4S/c13-10-5-9(6-14-12(10)17)20(18,19)15-11-4-2-1-3-8(11)7-16/h5-6,8,11,15-16H,1-4,7H2,(H,14,17) |
| InChIKey | LATAFVFNOWWUFO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |