C10H13ClN2O4S — CID 64607304
5-chloro-N-(oxan-4-yl)-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 64607304) has the molecular formula C10H13ClN2O4S and a molecular weight of 292.74 g/mol. Its IUPAC name is 5-chloro-N-(oxan-4-yl)-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-(oxan-4-yl)-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64607304 |
| Molecular Formula | C10H13ClN2O4S |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 5-chloro-N-(oxan-4-yl)-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | O=c1[nH]cc(S(=O)(=O)NC2CCOCC2)cc1Cl |
| InChI | InChI=1S/C10H13ClN2O4S/c11-9-5-8(6-12-10(9)14)18(15,16)13-7-1-3-17-4-2-7/h5-7,13H,1-4H2,(H,12,14) |
| InChIKey | ULCONZLGXAPHIM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |