C13H16F3NO3S — CID 103858682
2,3,4-trifluoro-N-[2-(hydroxymethyl)cyclohexyl]benzenesulfonamide (PubChem CID 103858682) has the molecular formula C13H16F3NO3S and a molecular weight of 323.34 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[2-(hydroxymethyl)cyclohexyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[2-(hydroxymethyl)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103858682 |
| Molecular Formula | C13H16F3NO3S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2,3,4-trifluoro-N-[2-(hydroxymethyl)cyclohexyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCCC1CO)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H16F3NO3S/c14-9-5-6-11(13(16)12(9)15)21(19,20)17-10-4-2-1-3-8(10)7-18/h5-6,8,10,17-18H,1-4,7H2 |
| InChIKey | FQNHIGFYFKJOHK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|