C14H13Cl2N3O4S — CID 9031200
2,5-dichloro-N-[2-(2-nitroanilino)ethyl]benzenesulfonamide (PubChem CID 9031200) has the molecular formula C14H13Cl2N3O4S and a molecular weight of 390.25 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(2-nitroanilino)ethyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[2-(2-nitroanilino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9031200 |
| Molecular Formula | C14H13Cl2N3O4S |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | 2,5-dichloro-N-[2-(2-nitroanilino)ethyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1NCCNS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H13Cl2N3O4S/c15-10-5-6-11(16)14(9-10)24(22,23)18-8-7-17-12-3-1-2-4-13(12)19(20)21/h1-6,9,17-18H,7-8H2 |
| InChIKey | JJDGFJWFALMANQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|