C16H14N2O6S — CID 142108459
5-hydroxy-2-(2-nitrophenyl)sulfonyl-3,5-dihydro-1H-2-benzazepin-4-one (PubChem CID 142108459) has the molecular formula C16H14N2O6S and a molecular weight of 362.36 g/mol. Its IUPAC name is 5-hydroxy-2-(2-nitrophenyl)sulfonyl-3,5-dihydro-1H-2-benzazepin-4-one.
| Compound Name | 5-hydroxy-2-(2-nitrophenyl)sulfonyl-3,5-dihydro-1H-2-benzazepin-4-one |
|---|---|
| PubChem CID | 142108459 |
| Molecular Formula | C16H14N2O6S |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 5-hydroxy-2-(2-nitrophenyl)sulfonyl-3,5-dihydro-1H-2-benzazepin-4-one |
| SMILES | O=C1CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])Cc2ccccc2C1O |
| InChI | InChI=1S/C16H14N2O6S/c19-14-10-17(9-11-5-1-2-6-12(11)16(14)20)25(23,24)15-8-4-3-7-13(15)18(21)22/h1-8,16,20H,9-10H2 |
| InChIKey | PUWSUAFGSLJDCH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|