About 1-phenyl-3-phenylsulfanylimidazo[1,5-a]pyridine
1-phenyl-3-phenylsulfanylimidazo[1,5-a]pyridine (PubChem CID 169101709) has the molecular formula C19H14N2S
and a molecular weight of 302.40 g/mol. Its IUPAC name is 1-phenyl-3-phenylsulfanylimidazo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 1-phenyl-3-phenylsulfanylimidazo[1,5-a]pyridine |
| PubChem CID | 169101709 |
| Molecular Formula | C19H14N2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 1-phenyl-3-phenylsulfanylimidazo[1,5-a]pyridine |
| SMILES | c1ccc(Sc2nc(-c3ccccc3)c3ccccn23)cc1 |
| InChI | InChI=1S/C19H14N2S/c1-3-9-15(10-4-1)18-17-13-7-8-14-21(17)19(20-18)22-16-11-5-2-6-12-16/h1-14H |
| InChIKey | RHDRJQSGWMDZIP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenyl-3-phenylsulfanylimidazo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-3-phenylsulfanylimidazo[1,5-a]pyridine?
The IUPAC name of 1-phenyl-3-phenylsulfanylimidazo[1,5-a]pyridine (CID 169101709) is 1-phenyl-3-phenylsulfanylimidazo[1,5-a]pyridine.
What is the SMILES notation for 1-phenyl-3-phenylsulfanylimidazo[1,5-a]pyridine?
The canonical SMILES for 1-phenyl-3-phenylsulfanylimidazo[1,5-a]pyridine is c1ccc(Sc2nc(-c3ccccc3)c3ccccn23)cc1.
What is the InChIKey of 1-phenyl-3-phenylsulfanylimidazo[1,5-a]pyridine?
The InChIKey is RHDRJQSGWMDZIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2S/c1-3-9-15(10-4-1)18-17-13-7-8-14-21(17)19(20-18)22-16-11-5-2-6-12-16/h1-14H.
What are the key properties of 1-phenyl-3-phenylsulfanylimidazo[1,5-a]pyridine?
1-phenyl-3-phenylsulfanylimidazo[1,5-a]pyridine has a molecular weight of 302.40 g/mol, XLogP of 5.15, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-3-phenylsulfanylimidazo[1,5-a]pyridine is sourced from PubChem (CID 169101709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).