C21H16N2O — CID 163207391
(4-methylphenyl)-(1-phenylimidazo[1,5-a]pyridin-3-yl)methanone (PubChem CID 163207391) has the molecular formula C21H16N2O and a molecular weight of 312.37 g/mol. Its IUPAC name is (4-methylphenyl)-(1-phenylimidazo[1,5-a]pyridin-3-yl)methanone.
| Compound Name | (4-methylphenyl)-(1-phenylimidazo[1,5-a]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 163207391 |
| Molecular Formula | C21H16N2O |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (4-methylphenyl)-(1-phenylimidazo[1,5-a]pyridin-3-yl)methanone |
| SMILES | Cc1ccc(C(=O)c2nc(-c3ccccc3)c3ccccn23)cc1 |
| InChI | InChI=1S/C21H16N2O/c1-15-10-12-17(13-11-15)20(24)21-22-19(16-7-3-2-4-8-16)18-9-5-6-14-23(18)21/h2-14H,1H3 |
| InChIKey | IZYIQDXKDQCJKF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |