C16H12N2O3 — CID 824944
(4-oxopyrido[1,2-a]pyrimidin-2-yl) 4-methylbenzoate (PubChem CID 824944) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is (4-oxopyrido[1,2-a]pyrimidin-2-yl) 4-methylbenzoate.
| Compound Name | (4-oxopyrido[1,2-a]pyrimidin-2-yl) 4-methylbenzoate |
|---|---|
| PubChem CID | 824944 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (4-oxopyrido[1,2-a]pyrimidin-2-yl) 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2cc(=O)n3ccccc3n2)cc1 |
| InChI | InChI=1S/C16H12N2O3/c1-11-5-7-12(8-6-11)16(20)21-14-10-15(19)18-9-3-2-4-13(18)17-14/h2-10H,1H3 |
| InChIKey | HLOMYVGMVXFHIX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |