About (4-oxopyrido[1,2-a]pyrimidin-2-yl) thiophene-2-carboxylate
(4-oxopyrido[1,2-a]pyrimidin-2-yl) thiophene-2-carboxylate (PubChem CID 10540095) has the molecular formula C13H8N2O3S
and a molecular weight of 272.29 g/mol. Its IUPAC name is (4-oxopyrido[1,2-a]pyrimidin-2-yl) thiophene-2-carboxylate.
Analyze (4-oxopyrido[1,2-a]pyrimidin-2-yl) thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxopyrido[1,2-a]pyrimidin-2-yl) thiophene-2-carboxylate?
The IUPAC name of (4-oxopyrido[1,2-a]pyrimidin-2-yl) thiophene-2-carboxylate (CID 10540095) is (4-oxopyrido[1,2-a]pyrimidin-2-yl) thiophene-2-carboxylate.
What is the SMILES notation for (4-oxopyrido[1,2-a]pyrimidin-2-yl) thiophene-2-carboxylate?
The canonical SMILES for (4-oxopyrido[1,2-a]pyrimidin-2-yl) thiophene-2-carboxylate is O=C(Oc1cc(=O)n2ccccc2n1)c1cccs1.
What is the InChIKey of (4-oxopyrido[1,2-a]pyrimidin-2-yl) thiophene-2-carboxylate?
The InChIKey is CXWPMMHGHUNGGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O3S/c16-12-8-11(14-10-5-1-2-6-15(10)12)18-13(17)9-4-3-7-19-9/h1-8H.
What are the key properties of (4-oxopyrido[1,2-a]pyrimidin-2-yl) thiophene-2-carboxylate?
(4-oxopyrido[1,2-a]pyrimidin-2-yl) thiophene-2-carboxylate has a molecular weight of 272.29 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxopyrido[1,2-a]pyrimidin-2-yl) thiophene-2-carboxylate is sourced from PubChem (CID 10540095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).