C12H12N2O2S — CID 126954535
2-(thiolan-3-yloxy)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 126954535) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 2-(thiolan-3-yloxy)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(thiolan-3-yloxy)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 126954535 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-(thiolan-3-yloxy)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(OC2CCSC2)nc2ccccn12 |
| InChI | InChI=1S/C12H12N2O2S/c15-12-7-11(16-9-4-6-17-8-9)13-10-3-1-2-5-14(10)12/h1-3,5,7,9H,4,6,8H2 |
| InChIKey | UBTYQKQALSBNKV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |